C21H23FN2 — CID 143621444
N-[2-(3-fluorophenyl)ethyl]-6-[(3E)-penta-1,3-dien-3-yl]-3-prop-1-en-2-ylpyridin-2-amine (PubChem CID 143621444) has the molecular formula C21H23FN2 and a molecular weight of 322.43 g/mol. Its IUPAC name is N-[2-(3-fluorophenyl)ethyl]-6-[(3E)-penta-1,3-dien-3-yl]-3-prop-1-en-2-ylpyridin-2-amine.
| Compound Name | N-[2-(3-fluorophenyl)ethyl]-6-[(3E)-penta-1,3-dien-3-yl]-3-prop-1-en-2-ylpyridin-2-amine |
|---|---|
| PubChem CID | 143621444 |
| Molecular Formula | C21H23FN2 |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | N-[2-(3-fluorophenyl)ethyl]-6-[(3E)-penta-1,3-dien-3-yl]-3-prop-1-en-2-ylpyridin-2-amine |
| SMILES | C=C/C(=C\C)c1ccc(C(=C)C)c(NCCc2cccc(F)c2)n1 |
| InChI | InChI=1S/C21H23FN2/c1-5-17(6-2)20-11-10-19(15(3)4)21(24-20)23-13-12-16-8-7-9-18(22)14-16/h5-11,14H,1,3,12-13H2,2,4H3,(H,23,24)/b17-6+ |
| InChIKey | GIIUIXIWOGWOID-UBKPWBPPSA-N |
| XLogP | 5.50 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|