C24H25FN4O2 — CID 67199786
2-[6-(1-ethoxyethenyl)-2-[2-(3-fluorophenyl)ethylamino]-3-pyridinyl]-2-pyridin-3-ylacetamide (PubChem CID 67199786) has the molecular formula C24H25FN4O2 and a molecular weight of 420.49 g/mol. Its IUPAC name is 2-[6-(1-ethoxyethenyl)-2-[2-(3-fluorophenyl)ethylamino]-3-pyridinyl]-2-pyridin-3-ylacetamide.
| Compound Name | 2-[6-(1-ethoxyethenyl)-2-[2-(3-fluorophenyl)ethylamino]-3-pyridinyl]-2-pyridin-3-ylacetamide |
|---|---|
| PubChem CID | 67199786 |
| Molecular Formula | C24H25FN4O2 |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 2-[6-(1-ethoxyethenyl)-2-[2-(3-fluorophenyl)ethylamino]-3-pyridinyl]-2-pyridin-3-ylacetamide |
| SMILES | C=C(OCC)c1ccc(C(C(N)=O)c2cccnc2)c(NCCc2cccc(F)c2)n1 |
| InChI | InChI=1S/C24H25FN4O2/c1-3-31-16(2)21-10-9-20(22(23(26)30)18-7-5-12-27-15-18)24(29-21)28-13-11-17-6-4-8-19(25)14-17/h4-10,12,14-15,22H,2-3,11,13H2,1H3,(H2,26,30)(H,28,29) |
| InChIKey | UTVWOBRCWXYCHZ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|