C22H21FN4O2 — CID 67200345
2-[6-acetyl-2-[2-(3-fluorophenyl)ethylamino]-3-pyridinyl]-2-pyridin-3-ylacetamide (PubChem CID 67200345) has the molecular formula C22H21FN4O2 and a molecular weight of 392.43 g/mol. Its IUPAC name is 2-[6-acetyl-2-[2-(3-fluorophenyl)ethylamino]-3-pyridinyl]-2-pyridin-3-ylacetamide.
| Compound Name | 2-[6-acetyl-2-[2-(3-fluorophenyl)ethylamino]-3-pyridinyl]-2-pyridin-3-ylacetamide |
|---|---|
| PubChem CID | 67200345 |
| Molecular Formula | C22H21FN4O2 |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 2-[6-acetyl-2-[2-(3-fluorophenyl)ethylamino]-3-pyridinyl]-2-pyridin-3-ylacetamide |
| SMILES | CC(=O)c1ccc(C(C(N)=O)c2cccnc2)c(NCCc2cccc(F)c2)n1 |
| InChI | InChI=1S/C22H21FN4O2/c1-14(28)19-8-7-18(20(21(24)29)16-5-3-10-25-13-16)22(27-19)26-11-9-15-4-2-6-17(23)12-15/h2-8,10,12-13,20H,9,11H2,1H3,(H2,24,29)(H,26,27) |
| InChIKey | IFDBHRAPSKGSBX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |