C13H12Cl2FN3 — CID 102756174
3,5-dichloro-6-N-[2-(3-fluorophenyl)ethyl]pyridine-2,6-diamine (PubChem CID 102756174) has the molecular formula C13H12Cl2FN3 and a molecular weight of 300.16 g/mol. Its IUPAC name is 3,5-dichloro-6-N-[2-(3-fluorophenyl)ethyl]pyridine-2,6-diamine.
| Compound Name | 3,5-dichloro-6-N-[2-(3-fluorophenyl)ethyl]pyridine-2,6-diamine |
|---|---|
| PubChem CID | 102756174 |
| Molecular Formula | C13H12Cl2FN3 |
| Molecular Weight | 300.16 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 3,5-dichloro-6-N-[2-(3-fluorophenyl)ethyl]pyridine-2,6-diamine |
| SMILES | Nc1nc(NCCc2cccc(F)c2)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H12Cl2FN3/c14-10-7-11(15)13(19-12(10)17)18-5-4-8-2-1-3-9(16)6-8/h1-3,6-7H,4-5H2,(H3,17,18,19) |
| InChIKey | PFCGHNHJRTVEHR-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.16 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |