C21H21FN6O — CID 59738211
6-carbamimidoyl-2-[2-(3-fluorophenyl)ethylamino]-N-(pyridin-3-ylmethyl)pyridine-3-carboxamide (PubChem CID 59738211) has the molecular formula C21H21FN6O and a molecular weight of 392.44 g/mol. Its IUPAC name is 6-carbamimidoyl-2-[2-(3-fluorophenyl)ethylamino]-N-(pyridin-3-ylmethyl)pyridine-3-carboxamide.
| Compound Name | 6-carbamimidoyl-2-[2-(3-fluorophenyl)ethylamino]-N-(pyridin-3-ylmethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 59738211 |
| Molecular Formula | C21H21FN6O |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 6-carbamimidoyl-2-[2-(3-fluorophenyl)ethylamino]-N-(pyridin-3-ylmethyl)pyridine-3-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)NCc2cccnc2)c(NCCc2cccc(F)c2)n1 |
| InChI | InChI=1S/C21H21FN6O/c22-16-5-1-3-14(11-16)8-10-26-20-17(6-7-18(28-20)19(23)24)21(29)27-13-15-4-2-9-25-12-15/h1-7,9,11-12H,8,10,13H2,(H3,23,24)(H,26,28)(H,27,29) |
| InChIKey | NASAZATWZZXUPU-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 116.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|