C24H28FN5O2 — CID 59738225
2-[2-(3-fluorophenyl)ethylamino]-6-(3-methoxypropylamino)-N-(pyridin-3-ylmethyl)pyridine-3-carboxamide (PubChem CID 59738225) has the molecular formula C24H28FN5O2 and a molecular weight of 437.52 g/mol. Its IUPAC name is 2-[2-(3-fluorophenyl)ethylamino]-6-(3-methoxypropylamino)-N-(pyridin-3-ylmethyl)pyridine-3-carboxamide.
| Compound Name | 2-[2-(3-fluorophenyl)ethylamino]-6-(3-methoxypropylamino)-N-(pyridin-3-ylmethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 59738225 |
| Molecular Formula | C24H28FN5O2 |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | 2-[2-(3-fluorophenyl)ethylamino]-6-(3-methoxypropylamino)-N-(pyridin-3-ylmethyl)pyridine-3-carboxamide |
| SMILES | COCCCNc1ccc(C(=O)NCc2cccnc2)c(NCCc2cccc(F)c2)n1 |
| InChI | InChI=1S/C24H28FN5O2/c1-32-14-4-12-27-22-9-8-21(24(31)29-17-19-6-3-11-26-16-19)23(30-22)28-13-10-18-5-2-7-20(25)15-18/h2-3,5-9,11,15-16H,4,10,12-14,17H2,1H3,(H,29,31)(H2,27,28,30) |
| InChIKey | CVPYWVJFZXZQQG-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|