C27H33FN6O2 — CID 59738261
6-[[5-(dimethylamino)-5-oxopentyl]amino]-2-[2-(3-fluorophenyl)ethylamino]-N-(pyridin-3-ylmethyl)pyridine-3-carboxamide (PubChem CID 59738261) has the molecular formula C27H33FN6O2 and a molecular weight of 492.60 g/mol. Its IUPAC name is 6-[[5-(dimethylamino)-5-oxopentyl]amino]-2-[2-(3-fluorophenyl)ethylamino]-N-(pyridin-3-ylmethyl)pyridine-3-carboxamide.
| Compound Name | 6-[[5-(dimethylamino)-5-oxopentyl]amino]-2-[2-(3-fluorophenyl)ethylamino]-N-(pyridin-3-ylmethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 59738261 |
| Molecular Formula | C27H33FN6O2 |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.26 |
| IUPAC Name | 6-[[5-(dimethylamino)-5-oxopentyl]amino]-2-[2-(3-fluorophenyl)ethylamino]-N-(pyridin-3-ylmethyl)pyridine-3-carboxamide |
| SMILES | CN(C)C(=O)CCCCNc1ccc(C(=O)NCc2cccnc2)c(NCCc2cccc(F)c2)n1 |
| InChI | InChI=1S/C27H33FN6O2/c1-34(2)25(35)10-3-4-15-30-24-12-11-23(27(36)32-19-21-8-6-14-29-18-21)26(33-24)31-16-13-20-7-5-9-22(28)17-20/h5-9,11-12,14,17-18H,3-4,10,13,15-16,19H2,1-2H3,(H,32,36)(H2,30,31,33) |
| InChIKey | FKZMFDPBBZTSMK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|