C22H21ClFN5O3 — CID 87303277
[3-[[[6-chloro-2-[2-(3-fluorophenyl)ethylamino]pyridine-3-carbonyl]amino]methyl]-2-pyridinyl]-methylcarbamic acid (PubChem CID 87303277) has the molecular formula C22H21ClFN5O3 and a molecular weight of 457.89 g/mol. Its IUPAC name is [3-[[[6-chloro-2-[2-(3-fluorophenyl)ethylamino]pyridine-3-carbonyl]amino]methyl]-2-pyridinyl]-methylcarbamic acid.
| Compound Name | [3-[[[6-chloro-2-[2-(3-fluorophenyl)ethylamino]pyridine-3-carbonyl]amino]methyl]-2-pyridinyl]-methylcarbamic acid |
|---|---|
| PubChem CID | 87303277 |
| Molecular Formula | C22H21ClFN5O3 |
| Molecular Weight | 457.89 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | [3-[[[6-chloro-2-[2-(3-fluorophenyl)ethylamino]pyridine-3-carbonyl]amino]methyl]-2-pyridinyl]-methylcarbamic acid |
| SMILES | CN(C(=O)O)c1ncccc1CNC(=O)c1ccc(Cl)nc1NCCc1cccc(F)c1 |
| InChI | InChI=1S/C22H21ClFN5O3/c1-29(22(31)32)20-15(5-3-10-26-20)13-27-21(30)17-7-8-18(23)28-19(17)25-11-9-14-4-2-6-16(24)12-14/h2-8,10,12H,9,11,13H2,1H3,(H,25,28)(H,27,30)(H,31,32) |
| InChIKey | DRPITQLYCGIYDF-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.89 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|