C10H13NS — CID 169233004
(NE)-N-[1-(2,6-dimethylphenyl)ethylidene]thiohydroxylamine (PubChem CID 169233004) has the molecular formula C10H13NS and a molecular weight of 179.29 g/mol. Its IUPAC name is (NE)-N-[1-(2,6-dimethylphenyl)ethylidene]thiohydroxylamine.
| Compound Name | (NE)-N-[1-(2,6-dimethylphenyl)ethylidene]thiohydroxylamine |
|---|---|
| PubChem CID | 169233004 |
| Molecular Formula | C10H13NS |
| Molecular Weight | 179.29 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | (NE)-N-[1-(2,6-dimethylphenyl)ethylidene]thiohydroxylamine |
| SMILES | C/C(=N\S)c1c(C)cccc1C |
| InChI | InChI=1S/C10H13NS/c1-7-5-4-6-8(2)10(7)9(3)11-12/h4-6,12H,1-3H3/b11-9+ |
| InChIKey | RIBRYHYTUHWXPU-PKNBQFBNSA-N |
| XLogP | 2.96 |
| TPSA | 12.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.29 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|