C24H40N4 — CID 145320894
N'-[(Z)-[amino-(2,6-dimethylphenyl)methylidene]amino]-2,6-dimethylbenzenecarboximidamide;ethane (PubChem CID 145320894) has the molecular formula C24H40N4 and a molecular weight of 384.61 g/mol. Its IUPAC name is N'-[(Z)-[amino-(2,6-dimethylphenyl)methylidene]amino]-2,6-dimethylbenzenecarboximidamide;ethane.
| Compound Name | N'-[(Z)-[amino-(2,6-dimethylphenyl)methylidene]amino]-2,6-dimethylbenzenecarboximidamide;ethane |
|---|---|
| PubChem CID | 145320894 |
| Molecular Formula | C24H40N4 |
| Molecular Weight | 384.61 g/mol |
| Exact Mass | 384.33 |
| IUPAC Name | N'-[(Z)-[amino-(2,6-dimethylphenyl)methylidene]amino]-2,6-dimethylbenzenecarboximidamide;ethane |
| SMILES | CC.CC.CC.Cc1cccc(C)c1/C(N)=N/N=C(\N)c1c(C)cccc1C |
| InChI | InChI=1S/C18H22N4.3C2H6/c1-11-7-5-8-12(2)15(11)17(19)21-22-18(20)16-13(3)9-6-10-14(16)4;3*1-2/h5-10H,1-4H3,(H2,19,21)(H2,20,22);3*1-2H3 |
| InChIKey | NASUPFFUWUINQR-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.61 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|