C14H23NO — CID 176970768
(Z)-4-amino-4-(2,6-dimethylphenyl)but-3-en-2-ol;ethane (PubChem CID 176970768) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is (Z)-4-amino-4-(2,6-dimethylphenyl)but-3-en-2-ol;ethane.
| Compound Name | (Z)-4-amino-4-(2,6-dimethylphenyl)but-3-en-2-ol;ethane |
|---|---|
| PubChem CID | 176970768 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | (Z)-4-amino-4-(2,6-dimethylphenyl)but-3-en-2-ol;ethane |
| SMILES | CC.Cc1cccc(C)c1/C(N)=C/C(C)O |
| InChI | InChI=1S/C12H17NO.C2H6/c1-8-5-4-6-9(2)12(8)11(13)7-10(3)14;1-2/h4-7,10,14H,13H2,1-3H3;1-2H3/b11-7-; |
| InChIKey | AAQIBFFOUTWZTD-AJULUCINSA-N |
| XLogP | 3.01 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |