C9H12N2O — CID 6299742
N'-hydroxy-2,6-dimethylbenzenecarboximidamide (PubChem CID 6299742) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is N'-hydroxy-2,6-dimethylbenzenecarboximidamide.
| Compound Name | N'-hydroxy-2,6-dimethylbenzenecarboximidamide |
|---|---|
| PubChem CID | 6299742 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | N'-hydroxy-2,6-dimethylbenzenecarboximidamide |
| SMILES | Cc1cccc(C)c1/C(N)=N\O |
| InChI | InChI=1S/C9H12N2O/c1-6-4-3-5-7(2)8(6)9(10)11-12/h3-5,12H,1-2H3,(H2,10,11) |
| InChIKey | NYZORJABIYPFLE-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|