C15H16O8 — CID 87093550
bis(2-hydroxypropanoyl) 3-methylbenzene-1,2-dicarboxylate (PubChem CID 87093550) has the molecular formula C15H16O8 and a molecular weight of 324.29 g/mol. Its IUPAC name is bis(2-hydroxypropanoyl) 3-methylbenzene-1,2-dicarboxylate.
| Compound Name | bis(2-hydroxypropanoyl) 3-methylbenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 87093550 |
| Molecular Formula | C15H16O8 |
| Molecular Weight | 324.29 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | bis(2-hydroxypropanoyl) 3-methylbenzene-1,2-dicarboxylate |
| SMILES | Cc1cccc(C(=O)OC(=O)C(C)O)c1C(=O)OC(=O)C(C)O |
| InChI | InChI=1S/C15H16O8/c1-7-5-4-6-10(14(20)22-12(18)8(2)16)11(7)15(21)23-13(19)9(3)17/h4-6,8-9,16-17H,1-3H3 |
| InChIKey | GGXAMIAWEJYKAM-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.29 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|