C21H32O4 — CID 69125695
bis(2-methylpentan-3-yl) 3-methylbenzene-1,2-dicarboxylate (PubChem CID 69125695) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is bis(2-methylpentan-3-yl) 3-methylbenzene-1,2-dicarboxylate.
| Compound Name | bis(2-methylpentan-3-yl) 3-methylbenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 69125695 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | bis(2-methylpentan-3-yl) 3-methylbenzene-1,2-dicarboxylate |
| SMILES | CCC(OC(=O)c1cccc(C)c1C(=O)OC(CC)C(C)C)C(C)C |
| InChI | InChI=1S/C21H32O4/c1-8-17(13(3)4)24-20(22)16-12-10-11-15(7)19(16)21(23)25-18(9-2)14(5)6/h10-14,17-18H,8-9H2,1-7H3 |
| InChIKey | AKAWFIXYXGQTDX-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |