About acetyl 2-iodo-3-methylbenzoate
acetyl 2-iodo-3-methylbenzoate (PubChem CID 175057557) has the molecular formula C10H9IO3
and a molecular weight of 304.08 g/mol. Its IUPAC name is acetyl 2-iodo-3-methylbenzoate.
Molecular Properties
| Compound Name | acetyl 2-iodo-3-methylbenzoate |
| PubChem CID | 175057557 |
| Molecular Formula | C10H9IO3 |
| Molecular Weight | 304.08 g/mol |
| Exact Mass | 303.96 |
| IUPAC Name | acetyl 2-iodo-3-methylbenzoate |
| SMILES | CC(=O)OC(=O)c1cccc(C)c1I |
| InChI | InChI=1S/C10H9IO3/c1-6-4-3-5-8(9(6)11)10(13)14-7(2)12/h3-5H,1-2H3 |
| InChIKey | RWIICUSOOKXCKE-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.08 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze acetyl 2-iodo-3-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyl 2-iodo-3-methylbenzoate?
The IUPAC name of acetyl 2-iodo-3-methylbenzoate (CID 175057557) is acetyl 2-iodo-3-methylbenzoate.
What is the SMILES notation for acetyl 2-iodo-3-methylbenzoate?
The canonical SMILES for acetyl 2-iodo-3-methylbenzoate is CC(=O)OC(=O)c1cccc(C)c1I.
What is the InChIKey of acetyl 2-iodo-3-methylbenzoate?
The InChIKey is RWIICUSOOKXCKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9IO3/c1-6-4-3-5-8(9(6)11)10(13)14-7(2)12/h3-5H,1-2H3.
What are the key properties of acetyl 2-iodo-3-methylbenzoate?
acetyl 2-iodo-3-methylbenzoate has a molecular weight of 304.08 g/mol, XLogP of 2.30, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetyl 2-iodo-3-methylbenzoate is sourced from PubChem (CID 175057557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).