C14H16O8 — CID 174493547
2-O-acetyl 1-O-ethyl benzene-1,2-dicarboxylate;2-hydroxyacetic acid (PubChem CID 174493547) has the molecular formula C14H16O8 and a molecular weight of 312.27 g/mol. Its IUPAC name is 2-O-acetyl 1-O-ethyl benzene-1,2-dicarboxylate;2-hydroxyacetic acid.
| Compound Name | 2-O-acetyl 1-O-ethyl benzene-1,2-dicarboxylate;2-hydroxyacetic acid |
|---|---|
| PubChem CID | 174493547 |
| Molecular Formula | C14H16O8 |
| Molecular Weight | 312.27 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 2-O-acetyl 1-O-ethyl benzene-1,2-dicarboxylate;2-hydroxyacetic acid |
| SMILES | CCOC(=O)c1ccccc1C(=O)OC(C)=O.O=C(O)CO |
| InChI | InChI=1S/C12H12O5.C2H4O3/c1-3-16-11(14)9-6-4-5-7-10(9)12(15)17-8(2)13;3-1-2(4)5/h4-7H,3H2,1-2H3;3H,1H2,(H,4,5) |
| InChIKey | HHFHZZCWHLZDPT-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.27 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|