C24H18O12S2 — CID 88531370
diacetyl 2-[[2,6-bis(acetyloxycarbonyl)phenyl]disulfanyl]benzene-1,3-dicarboxylate (PubChem CID 88531370) has the molecular formula C24H18O12S2 and a molecular weight of 562.53 g/mol. Its IUPAC name is diacetyl 2-[[2,6-bis(acetyloxycarbonyl)phenyl]disulfanyl]benzene-1,3-dicarboxylate.
| Compound Name | diacetyl 2-[[2,6-bis(acetyloxycarbonyl)phenyl]disulfanyl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 88531370 |
| Molecular Formula | C24H18O12S2 |
| Molecular Weight | 562.53 g/mol |
| Exact Mass | 562.02 |
| IUPAC Name | diacetyl 2-[[2,6-bis(acetyloxycarbonyl)phenyl]disulfanyl]benzene-1,3-dicarboxylate |
| SMILES | CC(=O)OC(=O)c1cccc(C(=O)OC(C)=O)c1SSc1c(C(=O)OC(C)=O)cccc1C(=O)OC(C)=O |
| InChI | InChI=1S/C24H18O12S2/c1-11(25)33-21(29)15-7-5-8-16(22(30)34-12(2)26)19(15)37-38-20-17(23(31)35-13(3)27)9-6-10-18(20)24(32)36-14(4)28/h5-10H,1-4H3 |
| InChIKey | NORWUMKDKOWLIQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 173.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.53 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|