C8H11NO2 — CID 69118528
3-(ethylamino)benzene-1,2-diol (PubChem CID 69118528) has the molecular formula C8H11NO2 and a molecular weight of 153.18 g/mol. Its IUPAC name is 3-(ethylamino)benzene-1,2-diol.
| Compound Name | 3-(ethylamino)benzene-1,2-diol |
|---|---|
| PubChem CID | 69118528 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | 3-(ethylamino)benzene-1,2-diol |
| SMILES | CCNc1cccc(O)c1O |
| InChI | InChI=1S/C8H11NO2/c1-2-9-6-4-3-5-7(10)8(6)11/h3-5,9-11H,2H2,1H3 |
| InChIKey | RNPFSSVESFAOOZ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|