C8H12N2O2 — CID 174526526
3-amino-6-(ethylamino)benzene-1,2-diol (PubChem CID 174526526) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is 3-amino-6-(ethylamino)benzene-1,2-diol.
| Compound Name | 3-amino-6-(ethylamino)benzene-1,2-diol |
|---|---|
| PubChem CID | 174526526 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 3-amino-6-(ethylamino)benzene-1,2-diol |
| SMILES | CCNc1ccc(N)c(O)c1O |
| InChI | InChI=1S/C8H12N2O2/c1-2-10-6-4-3-5(9)7(11)8(6)12/h3-4,10-12H,2,9H2,1H3 |
| InChIKey | YJPBFDTVFCODBE-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|