C21H48O6Si3 — CID 68656346
2,4,6-tri(butan-2-yl)-2,4,6-tripropoxy-1,3,5,2,4,6-trioxatrisilinane (PubChem CID 68656346) has the molecular formula C21H48O6Si3 and a molecular weight of 480.87 g/mol. Its IUPAC name is 2,4,6-tri(butan-2-yl)-2,4,6-tripropoxy-1,3,5,2,4,6-trioxatrisilinane.
| Compound Name | 2,4,6-tri(butan-2-yl)-2,4,6-tripropoxy-1,3,5,2,4,6-trioxatrisilinane |
|---|---|
| PubChem CID | 68656346 |
| Molecular Formula | C21H48O6Si3 |
| Molecular Weight | 480.87 g/mol |
| Exact Mass | 480.28 |
| IUPAC Name | 2,4,6-tri(butan-2-yl)-2,4,6-tripropoxy-1,3,5,2,4,6-trioxatrisilinane |
| SMILES | CCCO[Si]1(C(C)CC)O[Si](OCCC)(C(C)CC)O[Si](OCCC)(C(C)CC)O1 |
| InChI | InChI=1S/C21H48O6Si3/c1-10-16-22-28(19(7)13-4)25-29(20(8)14-5,23-17-11-2)27-30(26-28,21(9)15-6)24-18-12-3/h19-21H,10-18H2,1-9H3 |
| InChIKey | FVCGFDILSFOOAQ-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.87 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|