About 2-methoxy-2-propoxy-1,3,2-dioxasilolane
2-methoxy-2-propoxy-1,3,2-dioxasilolane (PubChem CID 59005009) has the molecular formula C6H14O4Si
and a molecular weight of 178.26 g/mol. Its IUPAC name is 2-methoxy-2-propoxy-1,3,2-dioxasilolane.
Molecular Properties
| Compound Name | 2-methoxy-2-propoxy-1,3,2-dioxasilolane |
| PubChem CID | 59005009 |
| Molecular Formula | C6H14O4Si |
| Molecular Weight | 178.26 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 2-methoxy-2-propoxy-1,3,2-dioxasilolane |
| SMILES | CCCO[Si]1(OC)OCCO1 |
| InChI | InChI=1S/C6H14O4Si/c1-3-4-8-11(7-2)9-5-6-10-11/h3-6H2,1-2H3 |
| InChIKey | BFZMLFSCGUSRML-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.26 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-2-propoxy-1,3,2-dioxasilolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-2-propoxy-1,3,2-dioxasilolane?
The IUPAC name of 2-methoxy-2-propoxy-1,3,2-dioxasilolane (CID 59005009) is 2-methoxy-2-propoxy-1,3,2-dioxasilolane.
What is the SMILES notation for 2-methoxy-2-propoxy-1,3,2-dioxasilolane?
The canonical SMILES for 2-methoxy-2-propoxy-1,3,2-dioxasilolane is CCCO[Si]1(OC)OCCO1.
What is the InChIKey of 2-methoxy-2-propoxy-1,3,2-dioxasilolane?
The InChIKey is BFZMLFSCGUSRML-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O4Si/c1-3-4-8-11(7-2)9-5-6-10-11/h3-6H2,1-2H3.
What are the key properties of 2-methoxy-2-propoxy-1,3,2-dioxasilolane?
2-methoxy-2-propoxy-1,3,2-dioxasilolane has a molecular weight of 178.26 g/mol, XLogP of 0.54, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-2-propoxy-1,3,2-dioxasilolane is sourced from PubChem (CID 59005009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).