C6H14O4Si — CID 59005009
2-methoxy-2-propoxy-1,3,2-dioxasilolane (PubChem CID 59005009) has the molecular formula C6H14O4Si and a molecular weight of 178.26 g/mol. Its IUPAC name is 2-methoxy-2-propoxy-1,3,2-dioxasilolane.
| Compound Name | 2-methoxy-2-propoxy-1,3,2-dioxasilolane |
|---|---|
| PubChem CID | 59005009 |
| Molecular Formula | C6H14O4Si |
| Molecular Weight | 178.26 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 2-methoxy-2-propoxy-1,3,2-dioxasilolane |
| SMILES | CCCO[Si]1(OC)OCCO1 |
| InChI | InChI=1S/C6H14O4Si/c1-3-4-8-11(7-2)9-5-6-10-11/h3-6H2,1-2H3 |
| InChIKey | BFZMLFSCGUSRML-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.26 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|