C9H20O4Si — CID 13268656
2,2-diethoxy-4,4-dimethyl-1,3,2-dioxasilinane (PubChem CID 13268656) has the molecular formula C9H20O4Si and a molecular weight of 220.34 g/mol. Its IUPAC name is 2,2-diethoxy-4,4-dimethyl-1,3,2-dioxasilinane.
| Compound Name | 2,2-diethoxy-4,4-dimethyl-1,3,2-dioxasilinane |
|---|---|
| PubChem CID | 13268656 |
| Molecular Formula | C9H20O4Si |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 2,2-diethoxy-4,4-dimethyl-1,3,2-dioxasilinane |
| SMILES | CCO[Si]1(OCC)OCCC(C)(C)O1 |
| InChI | InChI=1S/C9H20O4Si/c1-5-10-14(11-6-2)12-8-7-9(3,4)13-14/h5-8H2,1-4H3 |
| InChIKey | HXLGFKGGTKYTNQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|