C8H24O8Si4 — CID 173268693
2,2,4,4-tetraethoxy-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 173268693) has the molecular formula C8H24O8Si4 and a molecular weight of 360.62 g/mol. Its IUPAC name is 2,2,4,4-tetraethoxy-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2,2,4,4-tetraethoxy-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 173268693 |
| Molecular Formula | C8H24O8Si4 |
| Molecular Weight | 360.62 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 2,2,4,4-tetraethoxy-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | CCO[Si]1(OCC)O[SiH2]O[SiH2]O[Si](OCC)(OCC)O1 |
| InChI | InChI=1S/C8H24O8Si4/c1-5-9-19(10-6-2)14-17-13-18-15-20(16-19,11-7-3)12-8-4/h5-8,17-18H2,1-4H3 |
| InChIKey | GMPICDGHPBVGOC-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.62 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|