C20H56O16Si8 — CID 123519058
trimethoxy-[2-[2,4,4-tris(2-trimethoxysilylethyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]ethyl]silane (PubChem CID 123519058) has the molecular formula C20H56O16Si8 and a molecular weight of 777.34 g/mol. Its IUPAC name is trimethoxy-[2-[2,4,4-tris(2-trimethoxysilylethyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]ethyl]silane.
| Compound Name | trimethoxy-[2-[2,4,4-tris(2-trimethoxysilylethyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]ethyl]silane |
|---|---|
| PubChem CID | 123519058 |
| Molecular Formula | C20H56O16Si8 |
| Molecular Weight | 777.34 g/mol |
| Exact Mass | 776.17 |
| IUPAC Name | trimethoxy-[2-[2,4,4-tris(2-trimethoxysilylethyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]ethyl]silane |
| SMILES | CO[Si](CC[Si]1(CC[Si](OC)(OC)OC)O[SiH2]O[SiH2]O[Si](CC[Si](OC)(OC)OC)(CC[Si](OC)(OC)OC)O1)(OC)OC |
| InChI | InChI=1S/C20H56O16Si8/c1-21-41(22-2,23-3)17-13-39(14-18-42(24-4,25-5)26-6)34-37-33-38-35-40(36-39,15-19-43(27-7,28-8)29-9)16-20-44(30-10,31-11)32-12/h13-20,37-38H2,1-12H3 |
| InChIKey | YPDZAUDOYGVKMU-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 147.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.34 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|