C20H60O10Si10 — CID 123706901
2,2,4,4,6,6,8,8,10,10-decaethyl-1,3,5,7,9,11,13,15,17,19-decaoxa-2,4,6,8,10,12,14,16,18,20-decasilacycloicosane (PubChem CID 123706901) has the molecular formula C20H60O10Si10 and a molecular weight of 741.55 g/mol. Its IUPAC name is 2,2,4,4,6,6,8,8,10,10-decaethyl-1,3,5,7,9,11,13,15,17,19-decaoxa-2,4,6,8,10,12,14,16,18,20-decasilacycloicosane.
| Compound Name | 2,2,4,4,6,6,8,8,10,10-decaethyl-1,3,5,7,9,11,13,15,17,19-decaoxa-2,4,6,8,10,12,14,16,18,20-decasilacycloicosane |
|---|---|
| PubChem CID | 123706901 |
| Molecular Formula | C20H60O10Si10 |
| Molecular Weight | 741.55 g/mol |
| Exact Mass | 740.19 |
| IUPAC Name | 2,2,4,4,6,6,8,8,10,10-decaethyl-1,3,5,7,9,11,13,15,17,19-decaoxa-2,4,6,8,10,12,14,16,18,20-decasilacycloicosane |
| SMILES | CC[Si]1(CC)O[SiH2]O[SiH2]O[SiH2]O[SiH2]O[SiH2]O[Si](CC)(CC)O[Si](CC)(CC)O[Si](CC)(CC)O[Si](CC)(CC)O1 |
| InChI | InChI=1S/C20H60O10Si10/c1-11-36(12-2)25-34-23-32-21-31-22-33-24-35-26-37(13-3,14-4)28-39(17-7,18-8)30-40(19-9,20-10)29-38(15-5,16-6)27-36/h11-20,31-35H2,1-10H3 |
| InChIKey | STXCLQJYDCIKTJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.55 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|