C16H40Cl2O5Si5 — CID 14363072
2,6-dichloro-2,4,4,6,8,8,10,10-octaethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane (PubChem CID 14363072) has the molecular formula C16H40Cl2O5Si5 and a molecular weight of 523.83 g/mol. Its IUPAC name is 2,6-dichloro-2,4,4,6,8,8,10,10-octaethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane.
| Compound Name | 2,6-dichloro-2,4,4,6,8,8,10,10-octaethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane |
|---|---|
| PubChem CID | 14363072 |
| Molecular Formula | C16H40Cl2O5Si5 |
| Molecular Weight | 523.83 g/mol |
| Exact Mass | 522.11 |
| IUPAC Name | 2,6-dichloro-2,4,4,6,8,8,10,10-octaethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane |
| SMILES | CC[Si]1(Cl)O[Si](CC)(CC)O[Si](Cl)(CC)O[Si](CC)(CC)O[Si](CC)(CC)O1 |
| InChI | InChI=1S/C16H40Cl2O5Si5/c1-9-24(10-2)19-25(11-3,12-4)21-28(18,16-8)23-26(13-5,14-6)22-27(17,15-7)20-24/h9-16H2,1-8H3 |
| InChIKey | WHOIBDHQHRMQSY-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.83 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|