C10H25ClO5Si5 — CID 6329993
1,3,5,7,9-Pentaethyl-1-chlorocyclopentasiloxane (PubChem CID 6329993) has the molecular formula C10H25ClO5Si5 and a molecular weight of 401.19 g/mol.
| Compound Name | 1,3,5,7,9-Pentaethyl-1-chlorocyclopentasiloxane |
|---|---|
| PubChem CID | 6329993 |
| Molecular Formula | C10H25ClO5Si5 |
| Molecular Weight | 401.19 g/mol |
| Exact Mass | 400.02 |
| IUPAC Name | — |
| SMILES | CC[Si]1O[Si](CC)O[Si](CC)O[Si](Cl)(CC)O[Si](CC)O1 |
| InChI | InChI=1S/C10H25ClO5Si5/c1-6-17-12-18(7-2)14-20(9-4)16-21(11,10-5)15-19(8-3)13-17/h6-10H2,1-5H3 |
| InChIKey | UWPROSBOATUBNK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.19 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|