C15H40O5Si5 — CID 22748895
2,2,4,4,6-pentaethyl-6,8,8,10,10-pentamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane (PubChem CID 22748895) has the molecular formula C15H40O5Si5 and a molecular weight of 440.91 g/mol. Its IUPAC name is 2,2,4,4,6-pentaethyl-6,8,8,10,10-pentamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane.
| Compound Name | 2,2,4,4,6-pentaethyl-6,8,8,10,10-pentamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane |
|---|---|
| PubChem CID | 22748895 |
| Molecular Formula | C15H40O5Si5 |
| Molecular Weight | 440.91 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 2,2,4,4,6-pentaethyl-6,8,8,10,10-pentamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane |
| SMILES | CC[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](CC)(CC)O[Si](CC)(CC)O1 |
| InChI | InChI=1S/C15H40O5Si5/c1-11-23(10)17-21(6,7)16-22(8,9)18-24(12-2,13-3)20-25(14-4,15-5)19-23/h11-15H2,1-10H3 |
| InChIKey | DINFJYIHLPXNMB-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.91 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|