C4H22O7Si7 — CID 154020976
2,2,4,4-tetramethyl-1,3,5,7,9,11,13-heptaoxa-2,4,6,8,10,12,14-heptasilacyclotetradecane (PubChem CID 154020976) has the molecular formula C4H22O7Si7 and a molecular weight of 378.82 g/mol. Its IUPAC name is 2,2,4,4-tetramethyl-1,3,5,7,9,11,13-heptaoxa-2,4,6,8,10,12,14-heptasilacyclotetradecane.
| Compound Name | 2,2,4,4-tetramethyl-1,3,5,7,9,11,13-heptaoxa-2,4,6,8,10,12,14-heptasilacyclotetradecane |
|---|---|
| PubChem CID | 154020976 |
| Molecular Formula | C4H22O7Si7 |
| Molecular Weight | 378.82 g/mol |
| Exact Mass | 377.98 |
| IUPAC Name | 2,2,4,4-tetramethyl-1,3,5,7,9,11,13-heptaoxa-2,4,6,8,10,12,14-heptasilacyclotetradecane |
| SMILES | C[Si]1(C)O[SiH2]O[SiH2]O[SiH2]O[SiH2]O[SiH2]O[Si](C)(C)O1 |
| InChI | InChI=1S/C4H22O7Si7/c1-17(2)9-15-7-13-5-12-6-14-8-16-10-18(3,4)11-17/h12-16H2,1-4H3 |
| InChIKey | OTIAERJGCMAKNW-UHFFFAOYSA-N |
| XLogP | -3.49 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.82 |
| LogP ≤ 5 | -3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|