C4H14Cl2O4Si4 — CID 154413873
4,4-dichloro-2,2,6,6-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 154413873) has the molecular formula C4H14Cl2O4Si4 and a molecular weight of 309.40 g/mol. Its IUPAC name is 4,4-dichloro-2,2,6,6-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 4,4-dichloro-2,2,6,6-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 154413873 |
| Molecular Formula | C4H14Cl2O4Si4 |
| Molecular Weight | 309.40 g/mol |
| Exact Mass | 307.93 |
| IUPAC Name | 4,4-dichloro-2,2,6,6-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | C[Si]1(C)O[SiH2]O[Si](C)(C)O[Si](Cl)(Cl)O1 |
| InChI | InChI=1S/C4H14Cl2O4Si4/c1-12(2)7-11-8-13(3,4)10-14(5,6)9-12/h11H2,1-4H3 |
| InChIKey | PEIVWSPNQGMPKK-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.40 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|