C8H22O6Si4 — CID 173105370
4-(4,4,6,6-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)butanoic acid (PubChem CID 173105370) has the molecular formula C8H22O6Si4 and a molecular weight of 326.60 g/mol. Its IUPAC name is 4-(4,4,6,6-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)butanoic acid.
| Compound Name | 4-(4,4,6,6-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)butanoic acid |
|---|---|
| PubChem CID | 173105370 |
| Molecular Formula | C8H22O6Si4 |
| Molecular Weight | 326.60 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 4-(4,4,6,6-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)butanoic acid |
| SMILES | C[Si]1(C)O[SiH2]O[SiH](CCCC(=O)O)O[Si](C)(C)O1 |
| InChI | InChI=1S/C8H22O6Si4/c1-17(2)12-15-11-16(7-5-6-8(9)10)13-18(3,4)14-17/h16H,5-7,15H2,1-4H3,(H,9,10) |
| InChIKey | MGROBOZBJGIEJW-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.60 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|