About carbonic acid;decanedioic acid
carbonic acid;decanedioic acid (PubChem CID 159592525) has the molecular formula C12H22O10
and a molecular weight of 326.30 g/mol. Its IUPAC name is carbonic acid;decanedioic acid.
Molecular Properties
| Compound Name | carbonic acid;decanedioic acid |
| PubChem CID | 159592525 |
| Molecular Formula | C12H22O10 |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | carbonic acid;decanedioic acid |
| SMILES | O=C(O)CCCCCCCCC(=O)O.O=C(O)O.O=C(O)O |
| InChI | InChI=1S/C10H18O4.2CH2O3/c11-9(12)7-5-3-1-2-4-6-8-10(13)14;2*2-1(3)4/h1-8H2,(H,11,12)(H,13,14);2*(H2,2,3,4) |
| InChIKey | MKKOWLNMFMDUDL-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 189.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze carbonic acid;decanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonic acid;decanedioic acid?
The IUPAC name of carbonic acid;decanedioic acid (CID 159592525) is carbonic acid;decanedioic acid.
What is the SMILES notation for carbonic acid;decanedioic acid?
The canonical SMILES for carbonic acid;decanedioic acid is O=C(O)CCCCCCCCC(=O)O.O=C(O)O.O=C(O)O.
What is the InChIKey of carbonic acid;decanedioic acid?
The InChIKey is MKKOWLNMFMDUDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O4.2CH2O3/c11-9(12)7-5-3-1-2-4-6-8-10(13)14;2*2-1(3)4/h1-8H2,(H,11,12)(H,13,14);2*(H2,2,3,4).
What are the key properties of carbonic acid;decanedioic acid?
carbonic acid;decanedioic acid has a molecular weight of 326.30 g/mol, XLogP of 2.72, 9 rotatable bonds, 6 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;decanedioic acid is sourced from PubChem (CID 159592525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).