C4H18O4Si5 — CID 123479030
(4,4,6,6-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)silane (PubChem CID 123479030) has the molecular formula C4H18O4Si5 and a molecular weight of 270.61 g/mol. Its IUPAC name is (4,4,6,6-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)silane.
| Compound Name | (4,4,6,6-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)silane |
|---|---|
| PubChem CID | 123479030 |
| Molecular Formula | C4H18O4Si5 |
| Molecular Weight | 270.61 g/mol |
| Exact Mass | 270.01 |
| IUPAC Name | (4,4,6,6-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)silane |
| SMILES | C[Si]1(C)O[SiH2]O[SiH]([SiH3])O[Si](C)(C)O1 |
| InChI | InChI=1S/C4H18O4Si5/c1-12(2)6-10-5-11(9)7-13(3,4)8-12/h11H,10H2,1-4,9H3 |
| InChIKey | RWFVLXKBHKDLSE-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.61 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|