C12H28O5Si4 — CID 175187467
2,2,4,4-tetramethyl-6-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 175187467) has the molecular formula C12H28O5Si4 and a molecular weight of 364.70 g/mol. Its IUPAC name is 2,2,4,4-tetramethyl-6-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2,2,4,4-tetramethyl-6-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 175187467 |
| Molecular Formula | C12H28O5Si4 |
| Molecular Weight | 364.70 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 2,2,4,4-tetramethyl-6-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | C[Si]1(C)O[SiH2]O[SiH](CCC2CCC3OC3C2)O[Si](C)(C)O1 |
| InChI | InChI=1S/C12H28O5Si4/c1-20(2)15-18-14-19(16-21(3,4)17-20)8-7-10-5-6-11-12(9-10)13-11/h10-12,19H,5-9,18H2,1-4H3 |
| InChIKey | JKAOGQMDOIBOAB-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 49.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.70 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|