C37H64O8Si4 — CID 172516375
2,4,6,8-tetramethyl-2,4,6-tris[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]-8-[2-(3-oxatricyclo[3.2.1.02,4]octan-6-yl)ethyl]-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 172516375) has the molecular formula C37H64O8Si4 and a molecular weight of 749.25 g/mol. Its IUPAC name is 2,4,6,8-tetramethyl-2,4,6-tris[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]-8-[2-(3-oxatricyclo[3.2.1.02,4]octan-6-yl)ethyl]-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2,4,6,8-tetramethyl-2,4,6-tris[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]-8-[2-(3-oxatricyclo[3.2.1.02,4]octan-6-yl)ethyl]-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 172516375 |
| Molecular Formula | C37H64O8Si4 |
| Molecular Weight | 749.25 g/mol |
| Exact Mass | 748.37 |
| IUPAC Name | 2,4,6,8-tetramethyl-2,4,6-tris[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]-8-[2-(3-oxatricyclo[3.2.1.02,4]octan-6-yl)ethyl]-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | C[Si]1(CCC2CCC3OC3C2)O[Si](C)(CCC2CCC3OC3C2)O[Si](C)(CCC2CC3CC2C2OC32)O[Si](C)(CCC2CCC3OC3C2)O1 |
| InChI | InChI=1S/C37H64O8Si4/c1-46(15-11-24-5-8-30-33(19-24)38-30)42-47(2,16-12-25-6-9-31-34(20-25)39-31)44-49(4,18-14-27-22-28-23-29(27)37-36(28)41-37)45-48(3,43-46)17-13-26-7-10-32-35(21-26)40-32/h24-37H,5-23H2,1-4H3 |
| InChIKey | ARQVCEOVMYGQKO-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 87.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.25 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|