C40H72O8Si4 — CID 140688696
2,4,6,8-tetramethyl-2,4,6,8-tetrakis[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]-1,3,5,7-tetraoxa-2,4,6,8-tetrasilacyclododecane (PubChem CID 140688696) has the molecular formula C40H72O8Si4 and a molecular weight of 793.35 g/mol. Its IUPAC name is 2,4,6,8-tetramethyl-2,4,6,8-tetrakis[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]-1,3,5,7-tetraoxa-2,4,6,8-tetrasilacyclododecane.
| Compound Name | 2,4,6,8-tetramethyl-2,4,6,8-tetrakis[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]-1,3,5,7-tetraoxa-2,4,6,8-tetrasilacyclododecane |
|---|---|
| PubChem CID | 140688696 |
| Molecular Formula | C40H72O8Si4 |
| Molecular Weight | 793.35 g/mol |
| Exact Mass | 792.43 |
| IUPAC Name | 2,4,6,8-tetramethyl-2,4,6,8-tetrakis[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]-1,3,5,7-tetraoxa-2,4,6,8-tetrasilacyclododecane |
| SMILES | C[Si]1(CCC2CCC3OC3C2)CCCCO[Si](C)(CCC2CCC3OC3C2)O[Si](C)(CCC2CCC3OC3C2)O[Si](C)(CCC2CCC3OC3C2)O1 |
| InChI | InChI=1S/C40H72O8Si4/c1-49(21-15-29-7-11-33-37(25-29)42-33)20-6-5-19-41-50(2,22-16-30-8-12-34-38(26-30)43-34)47-52(4,24-18-32-10-14-36-40(28-32)45-36)48-51(3,46-49)23-17-31-9-13-35-39(27-31)44-35/h29-40H,5-28H2,1-4H3 |
| InChIKey | LSUXXWJLOHZQAV-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 87.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.35 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|