C10H26O4Si4 — CID 173216339
6-hex-5-enyl-2,2,4,4-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 173216339) has the molecular formula C10H26O4Si4 and a molecular weight of 322.66 g/mol. Its IUPAC name is 6-hex-5-enyl-2,2,4,4-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 6-hex-5-enyl-2,2,4,4-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 173216339 |
| Molecular Formula | C10H26O4Si4 |
| Molecular Weight | 322.66 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 6-hex-5-enyl-2,2,4,4-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | C=CCCCC[SiH]1O[SiH2]O[Si](C)(C)O[Si](C)(C)O1 |
| InChI | InChI=1S/C10H26O4Si4/c1-6-7-8-9-10-16-11-15-12-17(2,3)14-18(4,5)13-16/h6,16H,1,7-10,15H2,2-5H3 |
| InChIKey | AMFUGEVVURQBPY-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.66 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|