C5H14O3Si3 — CID 173183035
2,4-dimethyl-2-prop-2-enyl-1,3,5,2,4,6-trioxatrisilinane (PubChem CID 173183035) has the molecular formula C5H14O3Si3 and a molecular weight of 206.42 g/mol. Its IUPAC name is 2,4-dimethyl-2-prop-2-enyl-1,3,5,2,4,6-trioxatrisilinane.
| Compound Name | 2,4-dimethyl-2-prop-2-enyl-1,3,5,2,4,6-trioxatrisilinane |
|---|---|
| PubChem CID | 173183035 |
| Molecular Formula | C5H14O3Si3 |
| Molecular Weight | 206.42 g/mol |
| Exact Mass | 206.03 |
| IUPAC Name | 2,4-dimethyl-2-prop-2-enyl-1,3,5,2,4,6-trioxatrisilinane |
| SMILES | C=CC[Si]1(C)O[SiH2]O[SiH](C)O1 |
| InChI | InChI=1S/C5H14O3Si3/c1-4-5-11(3)7-9-6-10(2)8-11/h4,10H,1,5,9H2,2-3H3 |
| InChIKey | VYFLOCMXEIGHNU-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.42 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|