C3H10O3Si3 — CID 154149013
2-prop-2-enyl-1,3,5,2,4,6-trioxatrisilinane (PubChem CID 154149013) has the molecular formula C3H10O3Si3 and a molecular weight of 178.37 g/mol. Its IUPAC name is 2-prop-2-enyl-1,3,5,2,4,6-trioxatrisilinane.
| Compound Name | 2-prop-2-enyl-1,3,5,2,4,6-trioxatrisilinane |
|---|---|
| PubChem CID | 154149013 |
| Molecular Formula | C3H10O3Si3 |
| Molecular Weight | 178.37 g/mol |
| Exact Mass | 177.99 |
| IUPAC Name | 2-prop-2-enyl-1,3,5,2,4,6-trioxatrisilinane |
| SMILES | C=CC[SiH]1O[SiH2]O[SiH2]O1 |
| InChI | InChI=1S/C3H10O3Si3/c1-2-3-9-5-7-4-8-6-9/h2,9H,1,3,7-8H2 |
| InChIKey | XEQPDUJLSYXWOP-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.37 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|