C3H12O4Si4 — CID 154085708
2-prop-2-enyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 154085708) has the molecular formula C3H12O4Si4 and a molecular weight of 224.47 g/mol. Its IUPAC name is 2-prop-2-enyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2-prop-2-enyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 154085708 |
| Molecular Formula | C3H12O4Si4 |
| Molecular Weight | 224.47 g/mol |
| Exact Mass | 223.98 |
| IUPAC Name | 2-prop-2-enyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | C=CC[SiH]1O[SiH2]O[SiH2]O[SiH2]O1 |
| InChI | InChI=1S/C3H12O4Si4/c1-2-3-11-6-9-4-8-5-10-7-11/h2,11H,1,3,8-10H2 |
| InChIKey | OGDLPNQSUCXBCG-UHFFFAOYSA-N |
| XLogP | -2.53 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.47 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|