C7H14OSi2 — CID 175406933
2,4-bis(prop-2-enyl)-1,2,4-oxadisiletane (PubChem CID 175406933) has the molecular formula C7H14OSi2 and a molecular weight of 170.36 g/mol. Its IUPAC name is 2,4-bis(prop-2-enyl)-1,2,4-oxadisiletane.
| Compound Name | 2,4-bis(prop-2-enyl)-1,2,4-oxadisiletane |
|---|---|
| PubChem CID | 175406933 |
| Molecular Formula | C7H14OSi2 |
| Molecular Weight | 170.36 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 2,4-bis(prop-2-enyl)-1,2,4-oxadisiletane |
| SMILES | C=CC[SiH]1C[SiH](CC=C)O1 |
| InChI | InChI=1S/C7H14OSi2/c1-3-5-9-7-10(8-9)6-4-2/h3-4,9-10H,1-2,5-7H2 |
| InChIKey | ZSFFLHHEJUSXSB-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.36 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|