C6H12O2Si2 — CID 173077208
2,2-bis(prop-2-enyl)-1,3,2,4-dioxadisiletane (PubChem CID 173077208) has the molecular formula C6H12O2Si2 and a molecular weight of 172.33 g/mol. Its IUPAC name is 2,2-bis(prop-2-enyl)-1,3,2,4-dioxadisiletane.
| Compound Name | 2,2-bis(prop-2-enyl)-1,3,2,4-dioxadisiletane |
|---|---|
| PubChem CID | 173077208 |
| Molecular Formula | C6H12O2Si2 |
| Molecular Weight | 172.33 g/mol |
| Exact Mass | 172.04 |
| IUPAC Name | 2,2-bis(prop-2-enyl)-1,3,2,4-dioxadisiletane |
| SMILES | C=CC[Si]1(CC=C)O[SiH2]O1 |
| InChI | InChI=1S/C6H12O2Si2/c1-3-5-10(6-4-2)7-9-8-10/h3-4H,1-2,5-6,9H2 |
| InChIKey | NOOQVELYMZHOSM-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.33 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|