C9H15O6P3 — CID 155323373
2,4,6-tris(prop-2-enyl)-1,3,5,2λ5,4λ5,6λ5-trioxatriphosphinane 2,4,6-trioxide (PubChem CID 155323373) has the molecular formula C9H15O6P3 and a molecular weight of 312.14 g/mol. Its IUPAC name is 2,4,6-tris(prop-2-enyl)-1,3,5,2λ5,4λ5,6λ5-trioxatriphosphinane 2,4,6-trioxide.
| Compound Name | 2,4,6-tris(prop-2-enyl)-1,3,5,2λ5,4λ5,6λ5-trioxatriphosphinane 2,4,6-trioxide |
|---|---|
| PubChem CID | 155323373 |
| Molecular Formula | C9H15O6P3 |
| Molecular Weight | 312.14 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | 2,4,6-tris(prop-2-enyl)-1,3,5,2λ5,4λ5,6λ5-trioxatriphosphinane 2,4,6-trioxide |
| SMILES | C=CCP1(=O)OP(=O)(CC=C)OP(=O)(CC=C)O1 |
| InChI | InChI=1S/C9H15O6P3/c1-4-7-16(10)13-17(11,8-5-2)15-18(12,14-16)9-6-3/h4-6H,1-3,7-9H2 |
| InChIKey | PCNKXMLZBKUGJH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.14 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|