C9H17O5PS — CID 170686944
2-prop-2-enylsulfanyl-1,3,6,9-tetraoxa-2λ5-phosphacycloundecane 2-oxide (PubChem CID 170686944) has the molecular formula C9H17O5PS and a molecular weight of 268.27 g/mol. Its IUPAC name is 2-prop-2-enylsulfanyl-1,3,6,9-tetraoxa-2λ5-phosphacycloundecane 2-oxide.
| Compound Name | 2-prop-2-enylsulfanyl-1,3,6,9-tetraoxa-2λ5-phosphacycloundecane 2-oxide |
|---|---|
| PubChem CID | 170686944 |
| Molecular Formula | C9H17O5PS |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 2-prop-2-enylsulfanyl-1,3,6,9-tetraoxa-2λ5-phosphacycloundecane 2-oxide |
| SMILES | C=CCSP1(=O)OCCOCCOCCO1 |
| InChI | InChI=1S/C9H17O5PS/c1-2-9-16-15(10)13-7-5-11-3-4-12-6-8-14-15/h2H,1,3-9H2 |
| InChIKey | REQFDCKJLRMMEA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|