C13H23O7PS — CID 170686956
2-prop-2-ynylsulfanyl-1,3,6,9,12,15-hexaoxa-2λ5-phosphacycloheptadecane 2-oxide (PubChem CID 170686956) has the molecular formula C13H23O7PS and a molecular weight of 354.36 g/mol. Its IUPAC name is 2-prop-2-ynylsulfanyl-1,3,6,9,12,15-hexaoxa-2λ5-phosphacycloheptadecane 2-oxide.
| Compound Name | 2-prop-2-ynylsulfanyl-1,3,6,9,12,15-hexaoxa-2λ5-phosphacycloheptadecane 2-oxide |
|---|---|
| PubChem CID | 170686956 |
| Molecular Formula | C13H23O7PS |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 2-prop-2-ynylsulfanyl-1,3,6,9,12,15-hexaoxa-2λ5-phosphacycloheptadecane 2-oxide |
| SMILES | C#CCSP1(=O)OCCOCCOCCOCCOCCO1 |
| InChI | InChI=1S/C13H23O7PS/c1-2-13-22-21(14)19-11-9-17-7-5-15-3-4-16-6-8-18-10-12-20-21/h1H,3-13H2 |
| InChIKey | BGRMRPLDLGDLTG-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|