C18H36O8P2 — CID 12037889
4,7,13,16,21,24-hexaoxa-1λ5,10λ5-diphosphabicyclo[8.8.8]hexacosane 1,10-dioxide (PubChem CID 12037889) has the molecular formula C18H36O8P2 and a molecular weight of 442.43 g/mol. Its IUPAC name is 4,7,13,16,21,24-hexaoxa-1λ5,10λ5-diphosphabicyclo[8.8.8]hexacosane 1,10-dioxide.
| Compound Name | 4,7,13,16,21,24-hexaoxa-1λ5,10λ5-diphosphabicyclo[8.8.8]hexacosane 1,10-dioxide |
|---|---|
| PubChem CID | 12037889 |
| Molecular Formula | C18H36O8P2 |
| Molecular Weight | 442.43 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 4,7,13,16,21,24-hexaoxa-1λ5,10λ5-diphosphabicyclo[8.8.8]hexacosane 1,10-dioxide |
| SMILES | O=P12CCOCCOCCP(=O)(CCOCCOCC1)CCOCCOCC2 |
| InChI | InChI=1S/C18H36O8P2/c19-27-13-7-21-1-2-22-8-14-28(20,17-11-25-5-3-23-9-15-27)18-12-26-6-4-24-10-16-27/h1-18H2 |
| InChIKey | DUQLQBWZGUWZFH-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.43 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|