C10H13O2P — CID 4134640
4-phenyl-1,4lambda5-oxaphosphinane 4-oxide (PubChem CID 4134640) has the molecular formula C10H13O2P and a molecular weight of 196.19 g/mol. Its IUPAC name is 4-phenyl-1,4lambda5-oxaphosphinane 4-oxide.
| Compound Name | 4-phenyl-1,4lambda5-oxaphosphinane 4-oxide |
|---|---|
| PubChem CID | 4134640 |
| Molecular Formula | C10H13O2P |
| Molecular Weight | 196.19 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 4-phenyl-1,4lambda5-oxaphosphinane 4-oxide |
| SMILES | O=P1(c2ccccc2)CCOCC1 |
| InChI | InChI=1S/C10H13O2P/c11-13(8-6-12-7-9-13)10-4-2-1-3-5-10/h1-5H,6-9H2 |
| InChIKey | SVSWBELTSKUCCP-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.19 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|