About 3-bromo-4-methyl-1-phenyl-1λ5-phospholane 1-oxide
3-bromo-4-methyl-1-phenyl-1λ5-phospholane 1-oxide (PubChem CID 102170737) has the molecular formula C11H14BrOP
and a molecular weight of 273.11 g/mol. Its IUPAC name is 3-bromo-4-methyl-1-phenyl-1λ5-phospholane 1-oxide.
Molecular Properties
| Compound Name | 3-bromo-4-methyl-1-phenyl-1λ5-phospholane 1-oxide |
| PubChem CID | 102170737 |
| Molecular Formula | C11H14BrOP |
| Molecular Weight | 273.11 g/mol |
| Exact Mass | 272.00 |
| IUPAC Name | 3-bromo-4-methyl-1-phenyl-1λ5-phospholane 1-oxide |
| SMILES | CC1CP(=O)(c2ccccc2)CC1Br |
| InChI | InChI=1S/C11H14BrOP/c1-9-7-14(13,8-11(9)12)10-5-3-2-4-6-10/h2-6,9,11H,7-8H2,1H3 |
| InChIKey | JUBWDRNQSOHTRJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.11 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-4-methyl-1-phenyl-1λ5-phospholane 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-4-methyl-1-phenyl-1λ5-phospholane 1-oxide?
The IUPAC name of 3-bromo-4-methyl-1-phenyl-1λ5-phospholane 1-oxide (CID 102170737) is 3-bromo-4-methyl-1-phenyl-1λ5-phospholane 1-oxide.
What is the SMILES notation for 3-bromo-4-methyl-1-phenyl-1λ5-phospholane 1-oxide?
The canonical SMILES for 3-bromo-4-methyl-1-phenyl-1λ5-phospholane 1-oxide is CC1CP(=O)(c2ccccc2)CC1Br.
What is the InChIKey of 3-bromo-4-methyl-1-phenyl-1λ5-phospholane 1-oxide?
The InChIKey is JUBWDRNQSOHTRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14BrOP/c1-9-7-14(13,8-11(9)12)10-5-3-2-4-6-10/h2-6,9,11H,7-8H2,1H3.
What are the key properties of 3-bromo-4-methyl-1-phenyl-1λ5-phospholane 1-oxide?
3-bromo-4-methyl-1-phenyl-1λ5-phospholane 1-oxide has a molecular weight of 273.11 g/mol, XLogP of 3.09, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-4-methyl-1-phenyl-1λ5-phospholane 1-oxide is sourced from PubChem (CID 102170737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).