C16H17OP — CID 12543020
3,5-dimethyl-1-phenyl-2,3-dihydrophosphindole 1-oxide (PubChem CID 12543020) has the molecular formula C16H17OP and a molecular weight of 256.29 g/mol. Its IUPAC name is 3,5-dimethyl-1-phenyl-2,3-dihydrophosphindole 1-oxide.
| Compound Name | 3,5-dimethyl-1-phenyl-2,3-dihydrophosphindole 1-oxide |
|---|---|
| PubChem CID | 12543020 |
| Molecular Formula | C16H17OP |
| Molecular Weight | 256.29 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 3,5-dimethyl-1-phenyl-2,3-dihydrophosphindole 1-oxide |
| SMILES | Cc1ccc2c(c1)C(C)CP2(=O)c1ccccc1 |
| InChI | InChI=1S/C16H17OP/c1-12-8-9-16-15(10-12)13(2)11-18(16,17)14-6-4-3-5-7-14/h3-10,13H,11H2,1-2H3 |
| InChIKey | MDHYZYZXXZPYGZ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.29 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|