C28H26O2P2 — CID 102415355
2,3,7,8-tetramethyl-5,10-diphenylphosphanthrene 5,10-dioxide (PubChem CID 102415355) has the molecular formula C28H26O2P2 and a molecular weight of 456.46 g/mol. Its IUPAC name is 2,3,7,8-tetramethyl-5,10-diphenylphosphanthrene 5,10-dioxide.
| Compound Name | 2,3,7,8-tetramethyl-5,10-diphenylphosphanthrene 5,10-dioxide |
|---|---|
| PubChem CID | 102415355 |
| Molecular Formula | C28H26O2P2 |
| Molecular Weight | 456.46 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | 2,3,7,8-tetramethyl-5,10-diphenylphosphanthrene 5,10-dioxide |
| SMILES | Cc1cc2c(cc1C)P(=O)(c1ccccc1)c1cc(C)c(C)cc1P2(=O)c1ccccc1 |
| InChI | InChI=1S/C28H26O2P2/c1-19-15-25-26(16-20(19)2)32(30,24-13-9-6-10-14-24)28-18-22(4)21(3)17-27(28)31(25,29)23-11-7-5-8-12-23/h5-18H,1-4H3 |
| InChIKey | QJTGHXOPTIQKOK-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.46 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|